16 compounds in matrix
48 best compound-target hits listed
16 targets
• Combined reverse-docking score = 65% normalized docking-score estimator + 35% interaction-fingerprint component.
• When a native ligand exists for an experiment, the interaction-fingerprint component is driven by similarity to the native contact/H-bond pattern.
• When no native ligand exists, the interaction-fingerprint component falls back to contact richness within the experiment (normalized contacts and H-bonds).
Compounds × targets matrix
Each cell shows the best combined reverse-docking score found for that compound on that target. Blank cells mean no imported pose passed the current filters.
| Compound | Best | Mean | Targets | T02 | T03 | T04 | T06 | T07 | T08 | T09 | T10 | T11 | T13 | T14 | T15 | T16 | T18 | T20 | T21 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
OHD_MAC_29
[H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O
|
0.962 | 0.851 | 7 | 0.86 | 0.76 | 0.88 | 0.77 | 0.78 | 0.96 | 0.95 | |||||||||
|
OHD_MAC_2
[H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O
|
0.958 | 0.850 | 8 | 0.80 | 0.84 | 0.79 | 0.90 | 0.83 | 0.81 | 0.86 | 0.96 | ||||||||
|
OHD_MAC_28
[H]Oc1ccc(/C=[N+]([H])/N=c2/c3nc[n+]([H])c(N([H])c4ccc(F)c(Cl)c4)c3ncn2[H])cc1O[H]
|
0.951 | 0.951 | 1 | 0.95 | |||||||||||||||
|
OHD_MAC_28
[H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O
|
0.945 | 0.848 | 7 | 0.86 | 0.83 | 0.90 | 0.80 | 0.82 | 0.78 | 0.94 | |||||||||
|
OHD_MAC_22
[H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])N([H])[H])ncnc23)c1
|
0.943 | 0.903 | 3 | 0.94 | 0.85 | 0.92 | |||||||||||||
|
OHD_MAC_21
[H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])/N=C/c4ccc(O)cc4)ncnc23)c1
|
0.920 | 0.889 | 3 | 0.88 | 0.87 | 0.92 | |||||||||||||
|
OHD_MAC_26
[H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCSCC4)c3)ncnc12
|
0.900 | 0.816 | 4 | 0.83 | 0.73 | 0.90 | 0.80 | ||||||||||||
|
OHD_MAC_25
[H]N(c1cccc(OCC[N+]2([H])CCOCC2)c1)c1ncnc2c(N/N=C/c3ccccc3)ncnc12
|
0.897 | 0.870 | 2 | 0.84 | 0.90 | ||||||||||||||
|
OHD_MAC_23
[H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12
|
0.879 | 0.838 | 3 | 0.82 | 0.81 | 0.88 | |||||||||||||
|
OHD_MAC_24
[H]N(/N=C/c1ccc(Cl)cc1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12
|
0.873 | 0.868 | 2 | 0.87 | 0.86 | ||||||||||||||
|
OHD_MAC_20
[H]OCCCOc1cccc(N([H])c2c3c(nc[n+]2[H])/c(=N/[N+]([H])=C/c2cc(OC)c(O[H])c(OC)c2)ncn3[H])c1
|
0.865 | 0.865 | 1 | 0.87 | |||||||||||||||
|
OHD_MAC_24
[H]N(c1cccc(OCCN2CCOCC2)c1)c1ncnc2c(N/N=C/c3ccc(Cl)cc3)ncnc12
|
0.848 | 0.848 | 1 | 0.85 | |||||||||||||||
|
OHD_MAC_23
[H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCOCC4)c3)ncnc12
|
0.835 | 0.835 | 1 | 0.84 | |||||||||||||||
|
OHD_MAC_27
[H]N(c1ccc(F)c(Cl)c1)c1ncnc2c(N/N=C/c3ccc(OC)c(O)c3)ncnc12
|
0.809 | 0.806 | 3 | 0.81 | 0.80 | 0.81 | |||||||||||||
|
OHD_MAC_25
[H]N(c1cccc(OCCN2CCOCC2)c1)c1ncnc2c(N/N=C/c3ccccc3)ncnc12
|
0.807 | 0.807 | 1 | 0.81 | |||||||||||||||
|
OHD_MAC_29
[H]Oc1cc(/C=[N+]([H])/N=c2/c3nc[n+]([H])c(N([H])c4ccc(F)c(Cl)c4)c3ncn2[H])cc(O[H])c1O[H]
|
0.804 | 0.804 | 1 | 0.80 |
Best compound-target hits
The score column is the combined reverse-docking score. The next two columns expose its components: normalized score-estimator and interaction fingerprint.
| Compound | Target | Experiment | Combined | Score part | IFP part | IFP mode | Metric | Dock score | Inter norm | Contacts | HB | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.962 | 1.000 | 0.891 | native_similarity | final_rank_score | -12.9819 | -0.619505 | 11 | 8 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.958 | 1.000 | 0.881 | native_similarity | final_rank_score | -16.345 | -0.630705 | 16 | 14 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=[N+]([H])/N=c2/c3nc[n+]([H])c(N([H])c4ccc(F)c(Cl)c4)c3ncn2[H])cc1O[H] |
T10 native IFP available |
T10 dockmulti_91311c650f2e_T10 |
0.951 | 1.000 | 0.860 | native_similarity | final_rank_score | -21.7623 | -0.888962 | 18 | 9 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.949 | 1.000 | 0.854 | native_similarity | final_rank_score | -24.7719 | -0.858195 | 18 | 14 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.945 | 1.000 | 0.842 | native_similarity | final_rank_score | -21.8457 | -0.896861 | 18 | 13 | Pose |
| OHD_MAC_22 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])N([H])[H])ncnc23)c1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.943 | 1.000 | 0.839 | native_similarity | final_rank_score | -21.8293 | -1.14475 | 19 | 8 | Pose |
| OHD_MAC_21 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])/N=C/c4ccc(O)cc4)ncnc23)c1 |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.920 | 1.000 | 0.771 | native_similarity | final_rank_score | -20.5767 | -0.803382 | 16 | 14 | Pose |
| OHD_MAC_22 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])N([H])[H])ncnc23)c1 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.915 | 1.000 | 0.758 | native_similarity | final_rank_score | -27.2863 | -1.52566 | 19 | 12 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.904 | 1.000 | 0.725 | native_similarity | final_rank_score | -20.5428 | -0.677978 | 14 | 7 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.901 | 1.000 | 0.717 | native_similarity | final_rank_score | -25.7491 | -1.01922 | 16 | 9 | Pose |
| OHD_MAC_26 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCSCC4)c3)ncnc12 |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.900 | 1.000 | 0.715 | native_similarity | final_rank_score | -21.5065 | -0.679215 | 19 | 10 | Pose |
| OHD_MAC_25 [H]N(c1cccc(OCC[N+]2([H])CCOCC2)c1)c1ncnc2c(N/N=C/c3ccccc3)ncnc12 |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.897 | 1.000 | 0.706 | native_similarity | final_rank_score | -20.9518 | -0.667659 | 17 | 15 | Pose |
| OHD_MAC_21 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])/N=C/c4ccc(O)cc4)ncnc23)c1 |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.880 | 1.000 | 0.658 | native_similarity | final_rank_score | -20.0652 | -0.824695 | 20 | 11 | Pose |
| OHD_MAC_23 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12 |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.879 | 1.000 | 0.654 | native_similarity | final_rank_score | -13.3664 | -0.56479 | 16 | 9 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.877 | 1.000 | 0.648 | native_similarity | final_rank_score | -15.2382 | -0.692988 | 15 | 4 | Pose |
| OHD_MAC_24 [H]N(/N=C/c1ccc(Cl)cc1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.873 | 1.000 | 0.638 | native_similarity | final_rank_score | -19.6503 | -0.828414 | 19 | 9 | Pose |
| OHD_MAC_21 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])/N=C/c4ccc(O)cc4)ncnc23)c1 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.867 | 1.000 | 0.620 | native_similarity | final_rank_score | -15.7571 | -0.789359 | 16 | 9 | Pose |
| OHD_MAC_20 [H]OCCCOc1cccc(N([H])c2c3c(nc[n+]2[H])/c(=N/[N+]([H])=C/c2cc(OC)c(O[H])c(OC)c2)ncn3[H])c1 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.865 | 1.000 | 0.615 | native_similarity | final_rank_score | -18.6172 | -0.706055 | 19 | 5 | Pose |
| OHD_MAC_24 [H]N(/N=C/c1ccc(Cl)cc1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.863 | 1.000 | 0.610 | native_similarity | final_rank_score | -17.5913 | -0.62484 | 12 | 4 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T18 native IFP available |
T18 dockmulti_91311c650f2e_T18 |
0.862 | 1.000 | 0.606 | native_similarity | final_rank_score | -15.8512 | -0.546023 | 17 | 6 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.859 | 1.000 | 0.599 | native_similarity | final_rank_score | -19.6452 | -0.749109 | 19 | 7 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.859 | 1.000 | 0.599 | native_similarity | final_rank_score | -23.5916 | -0.837093 | 19 | 3 | Pose |
| OHD_MAC_22 [H]OCCCOc1cccc(N([H])c2ncnc3c(N([H])N([H])[H])ncnc23)c1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.851 | 1.000 | 0.574 | native_similarity | final_rank_score | -30.1572 | -1.42734 | 19 | 8 | Pose |
| OHD_MAC_24 [H]N(c1cccc(OCCN2CCOCC2)c1)c1ncnc2c(N/N=C/c3ccc(Cl)cc3)ncnc12 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.848 | 1.000 | 0.567 | native_similarity | final_rank_score | -17.5549 | -0.664695 | 18 | 1 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.845 | 1.000 | 0.556 | native_similarity | final_rank_score | -29.028 | -0.860623 | 21 | 6 | Pose |
| OHD_MAC_25 [H]N(c1cccc(OCC[N+]2([H])CCOCC2)c1)c1ncnc2c(N/N=C/c3ccccc3)ncnc12 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.843 | 1.000 | 0.550 | native_similarity | final_rank_score | -16.9378 | -0.517439 | 15 | 1 | Pose |
| OHD_MAC_23 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCOCC4)c3)ncnc12 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.835 | 1.000 | 0.530 | native_similarity | final_rank_score | -23.0566 | -0.624924 | 18 | 4 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T04 native IFP available |
T04 dockmulti_91311c650f2e_T04 |
0.834 | 1.000 | 0.525 | native_similarity | final_rank_score | -17.5083 | -0.672721 | 11 | 4 | Pose |
| OHD_MAC_26 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCSCC4)c3)ncnc12 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.830 | 1.000 | 0.515 | native_similarity | final_rank_score | -18.6671 | -0.64971 | 21 | 0 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.830 | 1.000 | 0.514 | native_similarity | final_rank_score | -23.0165 | -0.704217 | 22 | 9 | Pose |
| OHD_MAC_23 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.823 | 1.000 | 0.495 | native_similarity | final_rank_score | -19.3219 | -0.683686 | 19 | 3 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.819 | 1.000 | 0.484 | native_similarity | final_rank_score | -22.5111 | -0.695213 | 16 | 6 | Pose |
| OHD_MAC_23 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCC[N+]4([H])CCOCC4)c3)ncnc12 |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.813 | 1.000 | 0.465 | native_similarity | final_rank_score | -11.3302 | -0.492226 | 16 | 1 | Pose |
| OHD_MAC_27 [H]N(c1ccc(F)c(Cl)c1)c1ncnc2c(N/N=C/c3ccc(OC)c(O)c3)ncnc12 |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.809 | 1.000 | 0.455 | native_similarity | final_rank_score | -15.766 | -0.698837 | 22 | 7 | Pose |
| OHD_MAC_27 [H]N(c1ccc(F)c(Cl)c1)c1ncnc2c(N/N=C/c3ccc(OC)c(O)c3)ncnc12 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.809 | 1.000 | 0.453 | native_similarity | final_rank_score | -11.5456 | -0.596923 | 15 | 2 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.807 | 1.000 | 0.450 | native_similarity | final_rank_score | -16.6057 | -0.611665 | 18 | 7 | Pose |
| OHD_MAC_25 [H]N(c1cccc(OCCN2CCOCC2)c1)c1ncnc2c(N/N=C/c3ccccc3)ncnc12 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.807 | 1.000 | 0.450 | native_similarity | final_rank_score | -29.3096 | -0.990346 | 17 | 6 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=[N+]([H])/N=c2/c3nc[n+]([H])c(N([H])c4ccc(F)c(Cl)c4)c3ncn2[H])cc(O[H])c1O[H] |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.804 | 1.000 | 0.440 | native_similarity | final_rank_score | -14.1596 | -0.674754 | 13 | 8 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.802 | 1.000 | 0.433 | native_similarity | final_rank_score | -29.1964 | -0.727344 | 17 | 5 | Pose |
| OHD_MAC_27 [H]N(c1ccc(F)c(Cl)c1)c1ncnc2c(N/N=C/c3ccc(OC)c(O)c3)ncnc12 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.799 | 1.000 | 0.425 | native_similarity | final_rank_score | -16.1588 | -0.598599 | 15 | 6 | Pose |
| OHD_MAC_26 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCSCC4)c3)ncnc12 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.799 | 1.000 | 0.425 | native_similarity | final_rank_score | -19.7623 | -0.557739 | 15 | 4 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.799 | 1.000 | 0.425 | native_similarity | final_rank_score | -24.5961 | -1.01065 | 15 | 6 | Pose |
| OHD_MAC_2 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4cccc(OCc5ccncc5)c4)ncnc23)ccc1O |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.793 | 1.000 | 0.410 | native_similarity | final_rank_score | -18.5783 | -0.579324 | 13 | 4 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.779 | 1.000 | 0.368 | native_similarity | final_rank_score | -15.3958 | -0.685976 | 15 | 5 | Pose |
| OHD_MAC_28 [H]Oc1ccc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc1O |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.777 | 1.000 | 0.362 | native_similarity | final_rank_score | -18.1542 | -0.795481 | 13 | 13 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.774 | 1.000 | 0.353 | native_similarity | final_rank_score | -7.96208 | -0.77539 | 14 | 12 | Pose |
| OHD_MAC_29 [H]Oc1cc(/C=N/N([H])c2ncnc3c(N([H])c4ccc(F)c(Cl)c4)ncnc23)cc(O[H])c1O |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.758 | 1.000 | 0.310 | native_similarity | final_rank_score | -19.4338 | -0.682543 | 13 | 5 | Pose |
| OHD_MAC_26 [H]N(/N=C/c1cccc(Cl)c1)c1ncnc2c(N([H])c3cccc(OCCN4CCSCC4)c3)ncnc12 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.735 | 1.000 | 0.242 | native_similarity | final_rank_score | -17.4612 | -0.600381 | 12 | 2 | Pose |