10 compounds in matrix
15 best compound-target hits listed
13 targets
• Combined reverse-docking score = 65% normalized docking-score estimator + 35% interaction-fingerprint component.
• When a native ligand exists for an experiment, the interaction-fingerprint component is driven by similarity to the native contact/H-bond pattern.
• When no native ligand exists, the interaction-fingerprint component falls back to contact richness within the experiment (normalized contacts and H-bonds).
Compounds × targets matrix
Each cell shows the best combined reverse-docking score found for that compound on that target. Blank cells mean no imported pose passed the current filters.
| Compound | Best | Mean | Targets | T02 | T06 | T07 | T08 | T09 | T11 | T12 | T14 | T15 | T18 | T19 | T20 | T21 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
KB_chagas_179
[H]N([H])C(=O)c1ccccc1N([H])c1nc(N([H])C2CCCCC2)nc2c1ccn2[H]
|
0.936 | 0.903 | 2 | 0.87 | 0.94 | |||||||||||
|
KB_chagas_17
[H]N(C[C@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1
|
0.914 | 0.835 | 2 | 0.91 | 0.76 | |||||||||||
|
KB_chagas_179
[H]N([H])C(=O)c1ccccc1N([H])c1nc(N([H])C2CCCCC2)[n+]([H])c2c1ccn2[H]
|
0.905 | 0.905 | 1 | 0.90 | ||||||||||||
|
KB_chagas_170
[H]N1C(=O)CS[C@@H](c2ccc(OCc3ccccc3F)cc2)c2c(C)nn([H])c21
|
0.897 | 0.897 | 1 | 0.90 | ||||||||||||
|
KB_chagas_176
[H]N(CC(=O)N1N=C(c2ccccc2Cl)C[C@H]1c1ccc(OC)cc1)C(=O)C1CCC1
|
0.886 | 0.886 | 1 | 0.89 | ||||||||||||
|
KB_chagas_174
[H]n1c(C)c(Cc2c(C)n([H])c3ccccc3c2=O)c(=O)c2ccccc21
|
0.869 | 0.854 | 2 | 0.87 | 0.84 | |||||||||||
|
KB_chagas_173
[H][N+]([H])(Cc1ccc(C)c(F)c1)C1CCN(C[C@@H]2Cn3c(=O)ccc4ccc(=O)n2c43)CC1
|
0.849 | 0.808 | 2 | 0.85 | 0.77 | |||||||||||
|
KB_chagas_17
[H]N(C[C@@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1
|
0.819 | 0.816 | 2 | 0.82 | 0.81 | |||||||||||
|
KB_chagas_17
[H]N(C[C@H](c1cccnc1)N1CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1
|
0.812 | 0.812 | 1 | 0.81 | ||||||||||||
|
KB_chagas_173
[H][N+]([H])(Cc1ccc(C)c(F)c1)[C@H]1CC[N@@+]([H])(C[C@@H]2Cn3c(=O)ccc4ccc(=O)n2c43)CC1
|
0.780 | 0.780 | 1 | 0.78 |
Best compound-target hits
The score column is the combined reverse-docking score. The next two columns expose its components: normalized score-estimator and interaction fingerprint.
| Compound | Target | Experiment | Combined | Score part | IFP part | IFP mode | Metric | Dock score | Inter norm | Contacts | HB | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| KB_chagas_179 [H]N([H])C(=O)c1ccccc1N([H])c1nc(N([H])C2CCCCC2)nc2c1ccn2[H] |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.936 | 1.000 | 0.817 | native_similarity | final_rank_score | -9.9252 | -0.689237 | 10 | 5 | Pose |
| KB_chagas_17 [H]N(C[C@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.914 | 1.000 | 0.753 | native_similarity | final_rank_score | -19.3156 | -0.721115 | 15 | 3 | Pose |
| KB_chagas_179 [H]N([H])C(=O)c1ccccc1N([H])c1nc(N([H])C2CCCCC2)[n+]([H])c2c1ccn2[H] |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.905 | 1.000 | 0.728 | native_similarity | final_rank_score | -17.9529 | -0.847114 | 18 | 10 | Pose |
| KB_chagas_170 [H]N1C(=O)CS[C@@H](c2ccc(OCc3ccccc3F)cc2)c2c(C)nn([H])c21 |
T12 native IFP available |
T12 dockmulti_91311c650f2e_T12 |
0.897 | 1.000 | 0.707 | native_similarity | final_rank_score | -21.4344 | -0.942637 | 19 | 6 | Pose |
| KB_chagas_176 [H]N(CC(=O)N1N=C(c2ccccc2Cl)C[C@H]1c1ccc(OC)cc1)C(=O)C1CCC1 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.886 | 1.000 | 0.675 | native_similarity | final_rank_score | -12.8683 | -0.487061 | 14 | 1 | Pose |
| KB_chagas_179 [H]N([H])C(=O)c1ccccc1N([H])c1nc(N([H])C2CCCCC2)nc2c1ccn2[H] |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.871 | 1.000 | 0.631 | native_similarity | final_rank_score | -28.5378 | -1.24528 | 17 | 7 | Pose |
| KB_chagas_174 [H]n1c(C)c(Cc2c(C)n([H])c3ccccc3c2=O)c(=O)c2ccccc21 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.869 | 1.000 | 0.627 | native_similarity | final_rank_score | -25.8666 | -1.04547 | 17 | 1 | Pose |
| KB_chagas_173 [H][N+]([H])(Cc1ccc(C)c(F)c1)C1CCN(C[C@@H]2Cn3c(=O)ccc4ccc(=O)n2c43)CC1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.849 | 1.000 | 0.568 | native_similarity | final_rank_score | -28.7327 | -1.00893 | 16 | 2 | Pose |
| KB_chagas_174 [H]n1c(C)c(Cc2c(C)n([H])c3ccccc3c2=O)c(=O)c2ccccc21 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.838 | 1.000 | 0.537 | native_similarity | final_rank_score | -23.8919 | -0.972607 | 16 | 2 | Pose |
| KB_chagas_17 [H]N(C[C@@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.819 | 1.000 | 0.484 | native_similarity | final_rank_score | -20.9435 | -0.823755 | 18 | 3 | Pose |
| KB_chagas_17 [H]N(C[C@@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.813 | 1.000 | 0.466 | native_similarity | final_rank_score | -15.8207 | -0.660509 | 14 | 2 | Pose |
| KB_chagas_17 [H]N(C[C@H](c1cccnc1)N1CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.812 | 1.000 | 0.464 | native_similarity | final_rank_score | -17.3203 | -0.779039 | 18 | 2 | Pose |
| KB_chagas_173 [H][N+]([H])(Cc1ccc(C)c(F)c1)[C@H]1CC[N@@+]([H])(C[C@@H]2Cn3c(=O)ccc4ccc(=O)n2c43)CC1 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.780 | 1.000 | 0.372 | native_similarity | final_rank_score | -12.2738 | -0.601445 | 14 | 1 | Pose |
| KB_chagas_173 [H][N+]([H])(Cc1ccc(C)c(F)c1)C1CCN(C[C@@H]2Cn3c(=O)ccc4ccc(=O)n2c43)CC1 |
T18 native IFP available |
T18 dockmulti_91311c650f2e_T18 |
0.768 | 1.000 | 0.337 | native_similarity | final_rank_score | -21.3724 | -0.666991 | 10 | 3 | Pose |
| KB_chagas_17 [H]N(C[C@H](c1cccnc1)[N@@+]1([H])CCc2ccccc2C1)C(=O)C(=O)N([H])c1cccc(Cl)c1 |
T19 native IFP available |
T19 dockmulti_91311c650f2e_T19 |
0.755 | 1.000 | 0.301 | native_similarity | final_rank_score | -22.1683 | -0.849871 | 15 | 4 | Pose |