40 compounds in matrix
91 best compound-target hits listed
18 targets
• Combined reverse-docking score = 65% normalized docking-score estimator + 35% interaction-fingerprint component.
• When a native ligand exists for an experiment, the interaction-fingerprint component is driven by similarity to the native contact/H-bond pattern.
• When no native ligand exists, the interaction-fingerprint component falls back to contact richness within the experiment (normalized contacts and H-bonds).
Compounds × targets matrix
Each cell shows the best combined reverse-docking score found for that compound on that target. Blank cells mean no imported pose passed the current filters.
| Compound | Best | Mean | Targets | T02 | T03 | T04 | T06 | T07 | T08 | T09 | T10 | T11 | T12 | T13 | T14 | T15 | T16 | T18 | T19 | T20 | T21 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
KB_Leish_188
[H]n1c(C[N@@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21
|
0.984 | 0.869 | 4 | 0.87 | 0.84 | 0.78 | 0.98 | ||||||||||||||
|
KB_Leish_168
[H]N(c1ccc2c(c1)CS(=O)(=O)C2)c1nc(N([H])C(C)(C)C)c2ccn([H])c2[n+]1[H]
|
0.929 | 0.867 | 4 | 0.88 | 0.92 | 0.75 | 0.93 | ||||||||||||||
|
KB_Leish_137
CCS(=O)(=O)Nc1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccccc3OC)C2)cc1
|
0.923 | 0.871 | 2 | 0.92 | 0.82 | ||||||||||||||||
|
KB_Leish_125
[H]N([C@H](c1cc(OC)cc(OC)c1)c1n(C)cc[n+]1[H])S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1
|
0.922 | 0.852 | 2 | 0.78 | 0.92 | ||||||||||||||||
|
KB_Leish_1
[H]O[C@@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2
|
0.913 | 0.839 | 2 | 0.77 | 0.91 | ||||||||||||||||
|
KB_Leish_139
[H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccc(OC)c(OC)c3)C2)cc1)S(C)(=O)=O
|
0.912 | 0.841 | 4 | 0.80 | 0.90 | 0.75 | 0.91 | ||||||||||||||
|
KB_Leish_101
[H]N(c1ccc(C)cn1)c1nc([C@H]2CCC[N@+]2([H])Cc2ccn([H])n2)cs1
|
0.898 | 0.891 | 3 | 0.89 | 0.89 | 0.90 | |||||||||||||||
|
KB_Leish_175
[H]N([H])c1nc(C[N+]([H])([H])[C@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1
|
0.894 | 0.894 | 1 | 0.89 | |||||||||||||||||
|
KB_Leish_114
[H]N(c1ccc(OC)c(S(C)(=O)=O)c1)c1nccc(N(C)c2c3cccc(F)c3nn2[H])n1
|
0.890 | 0.882 | 2 | 0.87 | 0.89 | ||||||||||||||||
|
KB_Leish_175
[H]N([H])c1nc(C[N+]([H])([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1
|
0.886 | 0.836 | 4 | 0.89 | 0.84 | 0.80 | 0.82 | ||||||||||||||
|
KB_Leish_114
[H]N(c1ccc(OC)c(S(C)(=O)=O)c1)c1nc(N(C)c2nn([H])c3c(F)cccc23)cc[n+]1[H]
|
0.877 | 0.877 | 1 | 0.88 | |||||||||||||||||
|
KB_Leish_178
[H]N(C(=O)CN1CCN(c2ccccn2)CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl
|
0.874 | 0.857 | 2 | 0.87 | 0.84 | ||||||||||||||||
|
Z19456393
COc1ccc(C2=NC[C@H](CSc3nnc(-c4ccc5c(c4)OCO5)o3)S2)cc1
|
0.873 | 0.837 | 3 | 0.87 | 0.85 | 0.79 | |||||||||||||||
|
KB_Leish_102
[H]n1cc(C)c([C@@H]2CCC[N@+]([H])(Cc3nc4ccccc4n3C)C2)n1
|
0.873 | 0.839 | 2 | 0.87 | 0.81 | ||||||||||||||||
|
KB_Leish_175
[H]N([H])c1nc(CN([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1
|
0.866 | 0.829 | 3 | 0.87 | 0.81 | 0.81 | |||||||||||||||
|
KB_Leish_1
[H]O[C@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2
|
0.864 | 0.830 | 4 | 0.86 | 0.81 | 0.78 | 0.86 | ||||||||||||||
|
KB_Leish_18
[H][N+](C)(C)CC[N@@+]([H])(C)Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1
|
0.861 | 0.861 | 1 | 0.86 | |||||||||||||||||
|
KB_Leish_190
[H]N(C(=O)[C@@H](C)N([H])c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1)c1ccc(C#N)cc1
|
0.854 | 0.854 | 1 | 0.85 | |||||||||||||||||
|
KB_Leish_1
[H]O[C@@]12CCCC[C@@H]1[C@@H](c1ccc(OC)cc1)N(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2
|
0.852 | 0.852 | 1 | 0.85 | |||||||||||||||||
|
KB_Leish_1
[H]O[C@@]12CCCC[C@H]1[C@H](c1ccc(OC)cc1)[N@@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2
|
0.852 | 0.852 | 1 | 0.85 | |||||||||||||||||
|
KB_Leish_127
[H]N(c1cc(C)cc(C)c1)S(=O)(=O)c1cc(-c2cc(C)n([H])n2)ccc1C
|
0.852 | 0.841 | 2 | 0.83 | 0.85 | ||||||||||||||||
|
KB_Leish_182
[H]N(Cc1cccc(C#N)c1)c1ccc(-c2cnn(CC3CC3)c(=O)c2C#N)cc1
|
0.845 | 0.845 | 1 | 0.85 | |||||||||||||||||
|
KB_Leish_147
[H]N(C(=O)c1ccc([N+](=O)O)s1)c1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1
|
0.838 | 0.830 | 2 | 0.84 | 0.82 | ||||||||||||||||
|
KB_Leish_184
[H]N([H])c1cc(-c2ccc3ncnc(N4CCOCC4)c3c2)cnc1N([H])[H]
|
0.835 | 0.791 | 3 | 0.84 | 0.77 | 0.76 | |||||||||||||||
|
KB_Leish_188
[H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21
|
0.834 | 0.821 | 3 | 0.83 | 0.80 | 0.82 | |||||||||||||||
|
KB_Leish_110
[H]N(c1cccc(S(C)(=O)=O)c1)c1nccc(N([H])c2noc3ccc(C)cc23)n1
|
0.828 | 0.828 | 1 | 0.83 | |||||||||||||||||
|
KB_Leish_1
[H]O[C@]12CCCC[C@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2
|
0.826 | 0.826 | 1 | 0.83 | |||||||||||||||||
|
KB_Leish_102
[H]n1ncc(C)c1[C@H]1CCCN(Cc2nc3ccccc3n2C)C1
|
0.826 | 0.826 | 1 | 0.83 | |||||||||||||||||
|
KB_Leish_181
[H]N(Cc1ccc(-c2cccs2)cc1)C1CCN(CCn2c(=O)cnc3ccc(OC)nc32)CC1
|
0.822 | 0.795 | 2 | 0.82 | 0.77 | ||||||||||||||||
|
KB_Leish_102
[H]n1ncc(C)c1[C@H]1CCCN(Cc2n(C)c3ccccc3[n+]2[H])C1
|
0.820 | 0.788 | 2 | 0.82 | 0.76 | ||||||||||||||||
|
KB_Leish_165
[H]N(Cc1ccc2c(c1)OCO2)C(=O)CN(Cc1ccccn1)Cc1ccccn1
|
0.816 | 0.816 | 1 | 0.82 | |||||||||||||||||
|
KB_Leish_169
[H]N(Cc1csc(-c2cccs2)n1)C(=O)C[N+]([H])(Cc1ccccn1)Cc1ccccn1
|
0.816 | 0.816 | 1 | 0.82 | |||||||||||||||||
|
KB_Leish_178
[H]N(C(=O)CN1CCN(c2cccc[n+]2[H])CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl
|
0.813 | 0.797 | 2 | 0.81 | 0.78 | ||||||||||||||||
|
KB_Leish_119
[H]N([H])c1nc(C[N@@+]([H])(C)Cc2cccc(OC)c2)nc2sc(C)c(C)c12
|
0.812 | 0.812 | 1 | 0.81 | |||||||||||||||||
|
KB_Leish_169
[H]N(Cc1csc(-c2cccs2)n1)C(=O)CN(Cc1ccccn1)Cc1ccccn1
|
0.812 | 0.812 | 1 | 0.81 | |||||||||||||||||
|
KB_Leish_188
[H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21
|
0.812 | 0.812 | 1 | 0.81 | |||||||||||||||||
|
KB_Leish_173
[H]N(CCCC(=O)N([H])c1nc(-c2ccccn2)cs1)C(=O)c1ccc(Cl)cc1
|
0.809 | 0.809 | 1 | 0.81 | |||||||||||||||||
|
KB_Leish_181
[H]N(Cc1ccc(-c2cccs2)cc1)[C@H]1CC[N@@+]([H])(CCn2c(=O)cnc3ccc(OC)nc32)CC1
|
0.806 | 0.798 | 2 | 0.81 | 0.79 | ||||||||||||||||
|
KB_Leish_117
[H][N@@+](C)(Cc1nc2ccccc2n1C(C)C)[C@H](C)c1ccccn1
|
0.805 | 0.805 | 1 | 0.80 | |||||||||||||||||
|
KB_Leish_188
[H]n1c(C[N@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21
|
0.800 | 0.771 | 2 | 0.74 | 0.80 |
Best compound-target hits
The score column is the combined reverse-docking score. The next two columns expose its components: normalized score-estimator and interaction fingerprint.
| Compound | Target | Experiment | Combined | Score part | IFP part | IFP mode | Metric | Dock score | Inter norm | Contacts | HB | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.984 | 1.000 | 0.956 | native_similarity | final_rank_score | -12.9882 | -0.366984 | 9 | 3 | Pose |
| KB_Leish_168 [H]N(c1ccc2c(c1)CS(=O)(=O)C2)c1nc(N([H])C(C)(C)C)c2ccn([H])c2[n+]1[H] |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.929 | 1.000 | 0.796 | native_similarity | final_rank_score | -20.0834 | -0.700853 | 11 | 6 | Pose |
| KB_Leish_137 CCS(=O)(=O)Nc1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccccc3OC)C2)cc1 |
T10 native IFP available |
T10 dockmulti_91311c650f2e_T10 |
0.923 | 1.000 | 0.781 | native_similarity | final_rank_score | -17.4025 | -0.75889 | 15 | 9 | Pose |
| KB_Leish_125 [H]N([C@H](c1cc(OC)cc(OC)c1)c1n(C)cc[n+]1[H])S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.922 | 1.000 | 0.778 | native_similarity | final_rank_score | -9.68818 | -0.460123 | 12 | 3 | Pose |
| KB_Leish_168 [H]N(c1ccc2c(c1)CS(=O)(=O)C2)c1nc(N([H])C(C)(C)C)c2ccn([H])c2[n+]1[H] |
T10 native IFP available |
T10 dockmulti_91311c650f2e_T10 |
0.917 | 1.000 | 0.762 | native_similarity | final_rank_score | -17.8239 | -0.939894 | 16 | 11 | Pose |
| KB_Leish_1 [H]O[C@@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.913 | 0.994 | 0.763 | native_similarity | final_rank_score | -14.3137 | -0.459657 | 13 | 2 | Pose |
| KB_Leish_139 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccc(OC)c(OC)c3)C2)cc1)S(C)(=O)=O |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.912 | 1.000 | 0.748 | native_similarity | final_rank_score | -13.1265 | -0.690502 | 15 | 12 | Pose |
| KB_Leish_139 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccc(OC)c(OC)c3)C2)cc1)S(C)(=O)=O |
T10 native IFP available |
T10 dockmulti_91311c650f2e_T10 |
0.899 | 1.000 | 0.713 | native_similarity | final_rank_score | -15.9242 | -0.706863 | 14 | 7 | Pose |
| KB_Leish_101 [H]N(c1ccc(C)cn1)c1nc([C@H]2CCC[N@+]2([H])Cc2ccn([H])n2)cs1 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.898 | 1.000 | 0.710 | native_similarity | final_rank_score | -16.5271 | -0.627171 | 11 | 5 | Pose |
| KB_Leish_175 [H]N([H])c1nc(C[N+]([H])([H])[C@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.894 | 1.000 | 0.698 | native_similarity | final_rank_score | -29.0726 | -1.15574 | 19 | 6 | Pose |
| KB_Leish_114 [H]N(c1ccc(OC)c(S(C)(=O)=O)c1)c1nccc(N(C)c2c3cccc(F)c3nn2[H])n1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.890 | 1.000 | 0.687 | native_similarity | final_rank_score | -42.2073 | -0.993348 | 20 | 3 | Pose |
| KB_Leish_101 [H]N(c1ccc(C)cn1)c1nc([C@H]2CCC[N@+]2([H])Cc2ccn([H])n2)cs1 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.887 | 1.000 | 0.677 | native_similarity | final_rank_score | -23.8342 | -0.883699 | 20 | 2 | Pose |
| KB_Leish_101 [H]N(c1ccc(C)cn1)c1nc([C@H]2CCC[N@+]2([H])Cc2ccn([H])n2)cs1 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.886 | 1.000 | 0.676 | native_similarity | final_rank_score | -27.4014 | -1.05673 | 13 | 8 | Pose |
| KB_Leish_175 [H]N([H])c1nc(C[N+]([H])([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.886 | 1.000 | 0.673 | native_similarity | final_rank_score | -19.9839 | -0.844218 | 19 | 2 | Pose |
| KB_Leish_114 [H]N(c1ccc(OC)c(S(C)(=O)=O)c1)c1nc(N(C)c2nn([H])c3c(F)cccc23)cc[n+]1[H] |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.877 | 1.000 | 0.648 | native_similarity | final_rank_score | -39.9658 | -0.825648 | 21 | 9 | Pose |
| KB_Leish_168 [H]N(c1ccc2c(c1)CS(=O)(=O)C2)c1nc(N([H])C(C)(C)C)c2ccn([H])c2[n+]1[H] |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.876 | 1.000 | 0.645 | native_similarity | final_rank_score | -31.6353 | -1.30307 | 14 | 6 | Pose |
| KB_Leish_114 [H]N(c1ccc(OC)c(S(C)(=O)=O)c1)c1nccc(N(C)c2c3cccc(F)c3nn2[H])n1 |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.874 | 1.000 | 0.639 | native_similarity | final_rank_score | -37.3379 | -0.81296 | 18 | 2 | Pose |
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21 |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.874 | 1.000 | 0.639 | native_similarity | final_rank_score | -21.2297 | -0.642205 | 18 | 1 | Pose |
| KB_Leish_178 [H]N(C(=O)CN1CCN(c2ccccn2)CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.874 | 1.000 | 0.639 | native_similarity | final_rank_score | -22.0656 | -0.752142 | 18 | 1 | Pose |
| Z19456393 COc1ccc(C2=NC[C@H](CSc3nnc(-c4ccc5c(c4)OCO5)o3)S2)cc1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.873 | 1.000 | 0.639 | native_similarity | final_rank_score | -19.7942 | -0.779382 | 19 | 3 | Pose |
| KB_Leish_102 [H]n1cc(C)c([C@@H]2CCC[N@+]([H])(Cc3nc4ccccc4n3C)C2)n1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.873 | 1.000 | 0.636 | native_similarity | final_rank_score | -27.4262 | -1.30464 | 14 | 6 | Pose |
| KB_Leish_175 [H]N([H])c1nc(CN([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.866 | 1.000 | 0.617 | native_similarity | final_rank_score | -21.1088 | -0.957929 | 18 | 3 | Pose |
| KB_Leish_1 [H]O[C@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T21 native IFP available |
T21 dockmulti_91311c650f2e_T21 |
0.864 | 1.000 | 0.612 | native_similarity | final_rank_score | -17.6869 | -0.515741 | 13 | 5 | Pose |
| KB_Leish_18 [H][N+](C)(C)CC[N@@+]([H])(C)Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.861 | 1.000 | 0.603 | native_similarity | final_rank_score | -24.9865 | -1.05275 | 17 | 2 | Pose |
| KB_Leish_1 [H]O[C@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.860 | 0.976 | 0.644 | native_similarity | final_rank_score | -22.3497 | -0.730999 | 19 | 2 | Pose |
| KB_Leish_190 [H]N(C(=O)[C@@H](C)N([H])c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1)c1ccc(C#N)cc1 |
T12 native IFP available |
T12 dockmulti_91311c650f2e_T12 |
0.854 | 1.000 | 0.584 | native_similarity | final_rank_score | -26.1509 | -0.945595 | 17 | 8 | Pose |
| KB_Leish_1 [H]O[C@@]12CCCC[C@@H]1[C@@H](c1ccc(OC)cc1)N(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.852 | 0.977 | 0.620 | native_similarity | final_rank_score | -22.1999 | -0.722877 | 14 | 3 | Pose |
| KB_Leish_1 [H]O[C@@]12CCCC[C@H]1[C@H](c1ccc(OC)cc1)[N@@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.852 | 1.000 | 0.577 | native_similarity | final_rank_score | -14.4509 | -0.528577 | 15 | 0 | Pose |
| KB_Leish_127 [H]N(c1cc(C)cc(C)c1)S(=O)(=O)c1cc(-c2cc(C)n([H])n2)ccc1C |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.852 | 1.000 | 0.576 | native_similarity | final_rank_score | -27.1162 | -1.16311 | 14 | 3 | Pose |
| Z19456393 COc1ccc(C2=NC[C@H](CSc3nnc(-c4ccc5c(c4)OCO5)o3)S2)cc1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.850 | 1.000 | 0.573 | native_similarity | final_rank_score | -23.5022 | -0.872658 | 15 | 2 | Pose |
| KB_Leish_182 [H]N(Cc1cccc(C#N)c1)c1ccc(-c2cnn(CC3CC3)c(=O)c2C#N)cc1 |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.845 | 1.000 | 0.558 | native_similarity | final_rank_score | -26.8689 | -0.89736 | 17 | 4 | Pose |
| KB_Leish_178 [H]N(C(=O)CN1CCN(c2ccccn2)CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.841 | 1.000 | 0.545 | native_similarity | final_rank_score | -27.3923 | -0.830273 | 20 | 6 | Pose |
| KB_Leish_175 [H]N([H])c1nc(C[N+]([H])([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.838 | 1.000 | 0.539 | native_similarity | final_rank_score | -17.9194 | -0.785771 | 19 | 6 | Pose |
| KB_Leish_147 [H]N(C(=O)c1ccc([N+](=O)O)s1)c1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.838 | 1.000 | 0.539 | native_similarity | final_rank_score | -16.4845 | -0.790739 | 19 | 1 | Pose |
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.838 | 1.000 | 0.537 | native_similarity | final_rank_score | -17.9593 | -0.559793 | 16 | 0 | Pose |
| KB_Leish_184 [H]N([H])c1cc(-c2ccc3ncnc(N4CCOCC4)c3c2)cnc1N([H])[H] |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.835 | 1.000 | 0.529 | native_similarity | final_rank_score | -33.26 | -1.37021 | 17 | 8 | Pose |
| KB_Leish_188 [H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.834 | 1.000 | 0.524 | native_similarity | final_rank_score | -26.5211 | -0.739118 | 18 | 1 | Pose |
| KB_Leish_127 [H]N(c1cc(C)cc(C)c1)S(=O)(=O)c1cc(-c2cc(C)n([H])n2)ccc1C |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.831 | 1.000 | 0.518 | native_similarity | final_rank_score | -21.0599 | -0.9254 | 16 | 3 | Pose |
| KB_Leish_110 [H]N(c1cccc(S(C)(=O)=O)c1)c1nccc(N([H])c2noc3ccc(C)cc23)n1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.828 | 1.000 | 0.508 | native_similarity | final_rank_score | -30.7137 | -1.09263 | 16 | 4 | Pose |
| KB_Leish_1 [H]O[C@]12CCCC[C@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.826 | 0.956 | 0.584 | native_similarity | final_rank_score | -19.3003 | -0.69989 | 19 | 1 | Pose |
| KB_Leish_102 [H]n1ncc(C)c1[C@H]1CCCN(Cc2nc3ccccc3n2C)C1 |
T04 native IFP available |
T04 dockmulti_91311c650f2e_T04 |
0.826 | 1.000 | 0.502 | native_similarity | final_rank_score | -21.8784 | -1.10872 | 12 | 2 | Pose |
| KB_Leish_188 [H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.824 | 1.000 | 0.498 | native_similarity | final_rank_score | -19.598 | -0.662156 | 19 | 1 | Pose |
| KB_Leish_181 [H]N(Cc1ccc(-c2cccs2)cc1)C1CCN(CCn2c(=O)cnc3ccc(OC)nc32)CC1 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.822 | 1.000 | 0.492 | native_similarity | final_rank_score | -20.618 | -0.668115 | 20 | 2 | Pose |
| KB_Leish_147 [H]N(C(=O)c1ccc([N+](=O)O)s1)c1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.821 | 1.000 | 0.488 | native_similarity | final_rank_score | -25.8842 | -0.946784 | 16 | 1 | Pose |
| KB_Leish_102 [H]n1ncc(C)c1[C@H]1CCCN(Cc2n(C)c3ccccc3[n+]2[H])C1 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.820 | 1.000 | 0.487 | native_similarity | final_rank_score | -22.8779 | -1.06042 | 16 | 4 | Pose |
| KB_Leish_175 [H]N([H])c1nc(C[N+]([H])([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.820 | 1.000 | 0.485 | native_similarity | final_rank_score | -25.5014 | -0.791061 | 15 | 6 | Pose |
| KB_Leish_137 CCS(=O)(=O)Nc1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccccc3OC)C2)cc1 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.818 | 1.000 | 0.480 | native_similarity | final_rank_score | -15.8731 | -0.612731 | 12 | 4 | Pose |
| KB_Leish_165 [H]N(Cc1ccc2c(c1)OCO2)C(=O)CN(Cc1ccccn1)Cc1ccccn1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.816 | 1.000 | 0.475 | native_similarity | final_rank_score | -18.0974 | -0.725508 | 17 | 0 | Pose |
| KB_Leish_169 [H]N(Cc1csc(-c2cccs2)n1)C(=O)C[N+]([H])(Cc1ccccn1)Cc1ccccn1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.816 | 1.000 | 0.473 | native_similarity | final_rank_score | -24.1241 | -0.978311 | 15 | 1 | Pose |
| KB_Leish_178 [H]N(C(=O)CN1CCN(c2cccc[n+]2[H])CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.813 | 1.000 | 0.466 | native_similarity | final_rank_score | -23.0351 | -0.675037 | 14 | 2 | Pose |
| KB_Leish_175 [H]N([H])c1nc(CN([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.813 | 1.000 | 0.465 | native_similarity | final_rank_score | -19.5177 | -0.638684 | 8 | 10 | Pose |
| KB_Leish_119 [H]N([H])c1nc(C[N@@+]([H])(C)Cc2cccc(OC)c2)nc2sc(C)c(C)c12 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.812 | 1.000 | 0.464 | native_similarity | final_rank_score | -15.332 | -0.942234 | 18 | 1 | Pose |
| KB_Leish_169 [H]N(Cc1csc(-c2cccs2)n1)C(=O)CN(Cc1ccccn1)Cc1ccccn1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.812 | 1.000 | 0.464 | native_similarity | final_rank_score | -15.6916 | -0.792312 | 18 | 1 | Pose |
| KB_Leish_188 [H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.812 | 1.000 | 0.464 | native_similarity | final_rank_score | -25.4199 | -0.746918 | 18 | 2 | Pose |
| KB_Leish_1 [H]O[C@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.812 | 0.966 | 0.525 | native_similarity | final_rank_score | -19.6272 | -0.902159 | 18 | 4 | Pose |
| KB_Leish_173 [H]N(CCCC(=O)N([H])c1nc(-c2ccccn2)cs1)C(=O)c1ccc(Cl)cc1 |
T06 native IFP available |
T06 dockmulti_91311c650f2e_T06 |
0.809 | 1.000 | 0.454 | native_similarity | final_rank_score | -20.4173 | -0.916872 | 19 | 0 | Pose |
| KB_Leish_175 [H]N([H])c1nc(CN([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.807 | 1.000 | 0.449 | native_similarity | final_rank_score | -16.2267 | -0.59075 | 13 | 4 | Pose |
| KB_Leish_181 [H]N(Cc1ccc(-c2cccs2)cc1)[C@H]1CC[N@@+]([H])(CCn2c(=O)cnc3ccc(OC)nc32)CC1 |
T02 native IFP available |
T02 dockmulti_91311c650f2e_T02 |
0.806 | 1.000 | 0.445 | native_similarity | final_rank_score | -16.8235 | -0.753649 | 20 | 2 | Pose |
| KB_Leish_102 [H]n1cc(C)c([C@@H]2CCC[N@+]([H])(Cc3nc4ccccc4n3C)C2)n1 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.805 | 1.000 | 0.443 | native_similarity | final_rank_score | -18.9506 | -0.90001 | 9 | 3 | Pose |
| KB_Leish_117 [H][N@@+](C)(Cc1nc2ccccc2n1C(C)C)[C@H](C)c1ccccn1 |
T04 native IFP available |
T04 dockmulti_91311c650f2e_T04 |
0.805 | 1.000 | 0.442 | native_similarity | final_rank_score | -17.1098 | -0.906609 | 12 | 0 | Pose |
| KB_Leish_188 [H]n1c(CN(C)[C@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21 |
T10 native IFP available |
T10 dockmulti_91311c650f2e_T10 |
0.804 | 1.000 | 0.441 | native_similarity | final_rank_score | -11.6152 | -0.412866 | 14 | 2 | Pose |
| KB_Leish_139 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccc(OC)c(OC)c3)C2)cc1)S(C)(=O)=O |
T03 native IFP available |
T03 dockmulti_91311c650f2e_T03 |
0.804 | 1.000 | 0.440 | native_similarity | final_rank_score | -17.6195 | -0.64754 | 16 | 2 | Pose |
| KB_Leish_175 [H]N([H])c1nc(C[N+]([H])([H])[C@@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.802 | 1.000 | 0.433 | native_similarity | final_rank_score | -21.1874 | -0.749907 | 17 | 2 | Pose |
| KB_Leish_188 [H]n1c(C[N@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21 |
T13 native IFP available |
T13 dockmulti_91311c650f2e_T13 |
0.800 | 1.000 | 0.429 | native_similarity | final_rank_score | -25.9193 | -0.604065 | 18 | 4 | Pose |
| KB_Leish_123 O=C(c1ccc(O)c(Cl)c1)N1CCN(c2cnccn2)CC1 |
T04 native IFP available |
T04 dockmulti_91311c650f2e_T04 |
0.799 | 1.000 | 0.425 | native_similarity | final_rank_score | -24.8537 | -1.05822 | 11 | 2 | Pose |
| KB_Leish_188 [H]n1c(CN(C)[C@@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CCN(Cc4ccccc4)CC3)c21 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.797 | 1.000 | 0.420 | native_similarity | final_rank_score | -17.4059 | -0.473411 | 14 | 2 | Pose |
| KB_Leish_187 [H]N(C(=O)Cc1cc(Cl)ccc1OC)c1nc(-c2ccccn2)nn1[H] |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.795 | 1.000 | 0.413 | native_similarity | final_rank_score | -22.4414 | -1.07845 | 16 | 6 | Pose |
| KB_Leish_189 [H]O[C@H]1C[N@+]([H])(CCc2c(F)cnc3ccc(OC)nc23)CC[C@H]1N([H])C(=O)c1cc2c(s1)CCC2 |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.793 | 1.000 | 0.410 | native_similarity | final_rank_score | -14.8092 | -0.479893 | 11 | 4 | Pose |
| KB_Leish_181 [H]N(Cc1ccc(-c2cccs2)cc1)[C@H]1CC[N@@+]([H])(CCn2c(=O)cnc3ccc(OC)nc32)CC1 |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.791 | 1.000 | 0.402 | native_similarity | final_rank_score | -19.3277 | -0.648268 | 16 | 1 | Pose |
| KB_Leish_189 [H]O[C@H]1C[N@+]([H])(CCc2c(F)cnc3ccc(OC)nc23)CC[C@H]1N([H])C(=O)c1cc2c(s1)CCC2 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.790 | 1.000 | 0.400 | native_similarity | final_rank_score | -17.5736 | -0.608498 | 12 | 4 | Pose |
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@H]2CCCc3cccnc32)nc2c(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)cccc21 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.789 | 1.000 | 0.397 | native_similarity | final_rank_score | -16.3032 | -0.630705 | 15 | 2 | Pose |
| Z19456393 COc1ccc(C2=NC[C@H](CSc3nnc(-c4ccc5c(c4)OCO5)o3)S2)cc1 |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.787 | 1.000 | 0.392 | native_similarity | final_rank_score | -22.0967 | -0.770045 | 17 | 4 | Pose |
| KB_Leish_176 [H]N([H])c1ncc(-c2ccc(N([H])C(C)=O)cc2)cc1-c1nc2ccc(F)cc2n1[H] |
T09 native IFP available |
T09 dockmulti_91311c650f2e_T09 |
0.784 | 1.000 | 0.383 | native_similarity | final_rank_score | -26.6413 | -0.921491 | 15 | 4 | Pose |
| KB_Leish_1 [H]O[C@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.783 | 1.000 | 0.379 | native_similarity | final_rank_score | -19.5022 | -0.687016 | 16 | 3 | Pose |
| KB_Leish_125 [H]N([C@H](c1cc(OC)cc(OC)c1)c1n(C)cc[n+]1[H])S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.782 | 1.000 | 0.378 | native_similarity | final_rank_score | -15.4348 | -0.630156 | 14 | 4 | Pose |
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2c(C(=O)N3CCN(Cc4ccccc4)CC3)cccc21 |
T18 native IFP available |
T18 dockmulti_91311c650f2e_T18 |
0.780 | 1.000 | 0.373 | native_similarity | final_rank_score | -22.122 | -0.531814 | 12 | 2 | Pose |
| KB_Leish_178 [H]N(C(=O)CN1CCN(c2cccc[n+]2[H])CC1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
T18 native IFP available |
T18 dockmulti_91311c650f2e_T18 |
0.780 | 1.000 | 0.373 | native_similarity | final_rank_score | -22.7227 | -0.694866 | 12 | 2 | Pose |
| KB_Leish_138 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@@H](c3ccccc3OC)C2)cc1)S(C)(=O)=O |
T20 native IFP available |
T20 dockmulti_91311c650f2e_T20 |
0.779 | 1.000 | 0.369 | native_similarity | final_rank_score | -15.5545 | -0.591616 | 8 | 3 | Pose |
| KB_Leish_181 [H][N+]([H])(Cc1ccc(-c2cccs2)cc1)[C@H]1CC[N@+]([H])(CCn2c(=O)cnc3ccc(OC)nc32)CC1 |
T07 native IFP available |
T07 dockmulti_91311c650f2e_T07 |
0.779 | 1.000 | 0.368 | native_similarity | final_rank_score | -27.4083 | -0.749554 | 12 | 2 | Pose |
| Z57514561 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccccc3OC)C2)cc1)S(C)(=O)=O |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.777 | 1.000 | 0.362 | native_similarity | final_rank_score | -15.4953 | -0.634898 | 13 | 8 | Pose |
| KB_Leish_184 [H]N([H])c1cc(-c2ccc3ncnc(N4CCOCC4)c3c2)cnc1N([H])[H] |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.774 | 1.000 | 0.356 | native_similarity | final_rank_score | -21.2317 | -0.908428 | 10 | 5 | Pose |
| KB_Leish_181 [H]N(Cc1ccc(-c2cccs2)cc1)C1CCN(CCn2c(=O)cnc3ccc(OC)nc32)CC1 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.769 | 1.000 | 0.339 | native_similarity | final_rank_score | -19.9468 | -0.719235 | 19 | 4 | Pose |
| KB_Leish_1 [H]O[C@@]12CCCC[C@@H]1[C@H](c1ccc(OC)cc1)[N@@+]([H])(CC(=O)N([H])c1ccc(Cl)cc1Cl)CC2 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.766 | 1.000 | 0.331 | native_similarity | final_rank_score | -15.3502 | -0.582249 | 13 | 3 | Pose |
| KB_Leish_184 [H]N([H])c1cc(-c2ccc3ncnc(N4CCOCC4)c3c2)cnc1N([H])[H] |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.763 | 1.000 | 0.322 | native_similarity | final_rank_score | -21.1334 | -0.924921 | 14 | 4 | Pose |
| KB_Leish_102 [H]n1ncc(C)c1[C@H]1CCCN(Cc2n(C)c3ccccc3[n+]2[H])C1 |
T15 native IFP available |
T15 dockmulti_91311c650f2e_T15 |
0.756 | 1.000 | 0.302 | native_similarity | final_rank_score | -20.4299 | -0.878717 | 14 | 2 | Pose |
| KB_Leish_188 [H]n1c(C[N@@+]([H])(C)[C@H]2CCCc3cccnc32)nc2c(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)cccc21 |
T16 native IFP available |
T16 dockmulti_91311c650f2e_T16 |
0.749 | 1.000 | 0.283 | native_similarity | final_rank_score | -15.8791 | -0.496563 | 12 | 2 | Pose |
| KB_Leish_139 [H]N(c1ccc(C2=NN(C(=O)c3cccs3)[C@H](c3ccc(OC)c(OC)c3)C2)cc1)S(C)(=O)=O |
T11 native IFP available |
T11 dockmulti_91311c650f2e_T11 |
0.749 | 1.000 | 0.283 | native_similarity | final_rank_score | -15.6926 | -0.583201 | 18 | 4 | Pose |
| KB_Leish_168 [H]N(c1ccc2c(c1)CS(=O)(=O)C2)c1nc(N([H])C(C)(C)C)c2ccn([H])c2[n+]1[H] |
T14 native IFP available |
T14 dockmulti_91311c650f2e_T14 |
0.748 | 1.000 | 0.280 | native_similarity | final_rank_score | -16.1757 | -0.803543 | 12 | 4 | Pose |
| KB_Leish_188 [H]n1c(C[N@+]([H])(C)[C@@H]2CCCc3cccnc32)nc2cccc(C(=O)N3CC[N+]([H])(Cc4ccccc4)CC3)c21 |
T08 native IFP available |
T08 dockmulti_91311c650f2e_T08 |
0.743 | 1.000 | 0.265 | native_similarity | final_rank_score | -23.9027 | -0.635297 | 12 | 0 | Pose |
| KB_Leish_175 [H]N([H])c1nc(CN([H])[C@H](c2nc3ccccc3n2[H])C(C)C)nc(N([H])c2ccc(C)cc2)n1 |
T19 native IFP available |
T19 dockmulti_91311c650f2e_T19 |
0.738 | 1.000 | 0.253 | native_similarity | final_rank_score | -32.0555 | -1.0219 | 23 | 4 | Pose |
| KB_Leish_101 [H]N(c1ccc(C)cn1)c1nc([C@@H]2CCC[N@@+]2([H])Cc2ccn([H])n2)cs1 |
T19 native IFP available |
T19 dockmulti_91311c650f2e_T19 |
0.733 | 1.000 | 0.238 | native_similarity | final_rank_score | -33.262 | -1.21782 | 19 | 5 | Pose |